cas: 19728-76-8 — see every product listed under this CAS number, including other names
cis-Ethyl octahydro-1H-quinolizine-3-carboxylate, 95%, 95% (CAS 19728-76-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113APH-50mg |
| cas | 19728-76-8 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 534.80 Pln | |
| Chemat | 100mg | 957.20 Pln | |
| Chemat | 250mg | 2032.40 Pln | |
| Chemat | 1g | 5973.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl (3R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-3-carboxylate (CAS 19728-76-8) is a chemical compound with the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. IUPAC name: ethyl (3R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-3-carboxylate. InChIKey: ICWZXKPBSHGFEO-GHMZBOCLSA-N.
| Molecular formula | C12H21NO2 |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | ethyl (3R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-3-carboxylate |
| InChIKey | ICWZXKPBSHGFEO-GHMZBOCLSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@H]2CCCCN2C1 |
Computed by PubChem (NCBI)