cas: 1192549-09-9 — see every product listed under this CAS number, including other names
cis-tert-Butyl 3-aminocyclobutanecarboxylate hydrochloride, 95%, 95% (CAS 1192549-09-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IGB-1g |
| cas | 1192549-09-9 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 942.80 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 318.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride (CAS 1192549-09-9) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride. InChIKey: ZYVBBJZQKIWNNB-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride |
| InChIKey | ZYVBBJZQKIWNNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C1)N.Cl |
Computed by PubChem (NCBI)