cas: 1192549-09-9 — see every product listed under this CAS number, including other names
cis-tert-Butyl 3-aminocyclobutanecarboxylate hydrochloride, 97% (CAS 1192549-09-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F327346-100MG |
| cas | 1192549-09-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 378.01 Pln | |
| Fluorochem | 1g | 1205.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride (CAS 1192549-09-9) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride. InChIKey: ZYVBBJZQKIWNNB-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride |
| InChIKey | ZYVBBJZQKIWNNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C1)N.Cl |
Computed by PubChem (NCBI)