Products 2171519-89-2
CAS 2171519-89-2 appears in our catalog under these names: cjoc42/ 98.54% (existing batch purity), Cjoc42, Methyl 4-(4-(3-(tosyloxy)propyl)-1H-1,2,3-triazol-1-yl)benzoate, 98%, 98%, Cjoc42, 99.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 4-[4-[3-(4-methylphenyl)sulfonyloxypropyl]triazol-1-yl]benzoate (CAS 2171519-89-2) is a chemical compound with the molecular formula C20H21N3O5S and a molecular weight of 415.5 g/mol. IUPAC name: methyl 4-[4-[3-(4-methylphenyl)sulfonyloxypropyl]triazol-1-yl]benzoate. InChIKey: VYUDJPGSULLWAS-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O5S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | methyl 4-[4-[3-(4-methylphenyl)sulfonyloxypropyl]triazol-1-yl]benzoate |
| InChIKey | VYUDJPGSULLWAS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCC2=CN(N=N2)C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)