cas: 117384-45-9 — see every product listed under this CAS number, including other names
di-tert-Butyl (2R,3R)-2,3-dihydroxysuccinate, 95% (CAS 117384-45-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F612594-100MG |
| cas | 117384-45-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 1096.51 Pln | |
| Fluorochem | 5g | 3814.30 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ditert-butyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 117384-45-9) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: ditert-butyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: ITWOKJQQGHCDBL-HTQZYQBOSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | ditert-butyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | ITWOKJQQGHCDBL-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]([C@H](C(=O)OC(C)(C)C)O)O |
Computed by PubChem (NCBI)