cas: 2828020-90-0 — see every product listed under this CAS number, including other names
ethyl 4-(benzyloxycarbonylaminomethyl)-2,5-dimethyl-pyrazole-3-carboxylate, 97% (CAS 2828020-90-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F874833-100MG |
| cas | 2828020-90-0 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 872.63 Pln | |
| Fluorochem | 500mg | 1341.21 Pln | |
| Fluorochem | 1g | 1664.02 Pln | |
| Fluorochem | 5g | 4746.26 Pln | |
| Fluorochem | 10g | 7708.76 Pln | |
| Fluorochem | 25g | 15336.28 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 500mg | 803.60 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2848.40 Pln | |
| Chemat | 10g | 4706.00 Pln | |
| Chemat | 25g | 9347.60 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Ethyl 1,3-dimethyl-4-(phenylmethoxycarbonylaminomethyl)pyrazole-5-carboxylate (CAS 2828020-90-0) is a chemical compound with the molecular formula C17H21N3O4 and a molecular weight of 331.4 g/mol. IUPAC name: ethyl 1,3-dimethyl-4-(phenylmethoxycarbonylaminomethyl)pyrazole-5-carboxylate. InChIKey: NTAWXYKSPJADIB-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | ethyl 1,3-dimethyl-4-(phenylmethoxycarbonylaminomethyl)pyrazole-5-carboxylate |
| InChIKey | NTAWXYKSPJADIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NN1C)C)CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)