Products 1229017-38-2
CAS 1229017-38-2 is the registry number for 5,6-Diethyl-2-(5-nitro-2-propoxyphenyl)-4(3H)-pyrimidinone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,5-diethyl-2-(5-nitro-2-propoxyphenyl)-1H-pyrimidin-6-one (CAS 1229017-38-2) is a chemical compound with the molecular formula C17H21N3O4 and a molecular weight of 331.4 g/mol. IUPAC name: 4,5-diethyl-2-(5-nitro-2-propoxyphenyl)-1H-pyrimidin-6-one. InChIKey: NLOSJCOMVHOHPX-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 4,5-diethyl-2-(5-nitro-2-propoxyphenyl)-1H-pyrimidin-6-one |
| InChIKey | NLOSJCOMVHOHPX-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)[N+](=O)[O-])C2=NC(=C(C(=O)N2)CC)CC |
Computed by PubChem (NCBI)