Products 2682097-60-3
CAS 2682097-60-3 is the registry number for (S)-2-(7-Acetamido-1H-indole-2-carboxamido)-4-methylpentanoic acid 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2S)-2-[(7-acetamido-1H-indole-2-carbonyl)amino]-4-methylpentanoic acid (CAS 2682097-60-3) is a chemical compound with the molecular formula C17H21N3O4 and a molecular weight of 331.4 g/mol. IUPAC name: (2S)-2-[(7-acetamido-1H-indole-2-carbonyl)amino]-4-methylpentanoic acid. InChIKey: IUXRRWJFRZBYOS-AWEZNQCLSA-N.
| Molecular formula | C17H21N3O4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (2S)-2-[(7-acetamido-1H-indole-2-carbonyl)amino]-4-methylpentanoic acid |
| InChIKey | IUXRRWJFRZBYOS-AWEZNQCLSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C1=CC2=C(N1)C(=CC=C2)NC(=O)C |
Computed by PubChem (NCBI)