cas: 1379345-44-4 — see every product listed under this CAS number, including other names
ethyl 4-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate, 97%, 97% (CAS 1379345-44-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILOZ-100mg |
| cas | 1379345-44-4 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 500mg | 342.80 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 1826.00 Pln | |
| Chemat | 10g | 3035.60 Pln | |
| Chemat | 25g | 6002.00 Pln | |
| Chemat | 100g | 17699.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-methylpyrrolo[2,3-d][1,3]thiazole-5-carboxylate (CAS 1379345-44-4) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: ethyl 4-methylpyrrolo[2,3-d][1,3]thiazole-5-carboxylate. InChIKey: XWFJPGZVQINIEB-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | ethyl 4-methylpyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| InChIKey | XWFJPGZVQINIEB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C)N=CS2 |
Computed by PubChem (NCBI)