cas: 169773-94-8 — see every product listed under this CAS number, including other names
ethyl 5-bromo-6-hydroxynicotinate, 96% (CAS 169773-94-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517843-250MG |
| cas | 169773-94-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1903.51 Pln | |
| Fluorochem | 10g | 3387.37 Pln | |
| Fluorochem | 25g | 6485.23 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-bromo-6-oxo-1H-pyridine-3-carboxylate (CAS 169773-94-8) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: ethyl 5-bromo-6-oxo-1H-pyridine-3-carboxylate. InChIKey: NTQHDRQVVANNHZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | ethyl 5-bromo-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | NTQHDRQVVANNHZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=O)C(=C1)Br |
Computed by PubChem (NCBI)