cas: 2007910-58-7 — see every product listed under this CAS number, including other names
exo-3-Amino-8-Boc-8-azabicyclo[3.2.1]octane acetate, 97%, 97% (CAS 2007910-58-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CYX-50g |
| cas | 2007910-58-7 |
| size | 50g |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 2277.20 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 10g | 688.40 Pln | |
| Chemat | 25g | 1422.80 Pln | |
| Chemat | 100g | 4331.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Acetic acid;tert-butyl (1R,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 2007910-58-7) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: acetic acid;tert-butyl (1R,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: MGOGAGPPPDSADC-NJOOWJKCSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | acetic acid;tert-butyl (1R,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | MGOGAGPPPDSADC-NJOOWJKCSA-N |
| SMILES | CC(=O)O.CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)N |
Computed by PubChem (NCBI)