CAS 1666119-75-0 appears in our catalog under these names: hMAO-B-IN-4/ 99.88% (existing batch purity), hMAO–B–IN–4, (E)-3-(4-(Benzyloxy)phenyl)-1-(thiophen-2-yl)prop-2-en-1-one, 95%, 95%, hMAO-B-IN-4, 99.70%, hMAO-B-IN-4, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
(E)-3-(4-phenylmethoxyphenyl)-1-thiophen-2-ylprop-2-en-1-one (CAS 1666119-75-0) is a chemical compound with the molecular formula C20H16O2S and a molecular weight of 320.4 g/mol. IUPAC name: (E)-3-(4-phenylmethoxyphenyl)-1-thiophen-2-ylprop-2-en-1-one. InChIKey: MKSMRBDQELHEBO-JLHYYAGUSA-N.
| Molecular formula | C20H16O2S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | (E)-3-(4-phenylmethoxyphenyl)-1-thiophen-2-ylprop-2-en-1-one |
| InChIKey | MKSMRBDQELHEBO-JLHYYAGUSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)