Products 1234708-04-3
CAS 1234708-04-3 appears in our catalog under these names: hPGDS-IN-1/ 99.74% (existing batch purity), SAR191801, SAR191801, 98%, 98%, hPGDS-IN-1, 99.92%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10 mg.
N-[[3-[5-(2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-pyridin-2-ylpyrimidine-5-carboxamide (CAS 1234708-04-3) is a chemical compound with the molecular formula C22H20N6O3 and a molecular weight of 416.4 g/mol. IUPAC name: N-[[3-[5-(2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-pyridin-2-ylpyrimidine-5-carboxamide. InChIKey: VJCLAPUACUQZOV-UHFFFAOYSA-N.
| Molecular formula | C22H20N6O3 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | N-[[3-[5-(2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-pyridin-2-ylpyrimidine-5-carboxamide |
| InChIKey | VJCLAPUACUQZOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC(=NO1)C2=CC=CC(=C2)CNC(=O)C3=CN=C(N=C3)C4=CC=CC=N4)O |
Computed by PubChem (NCBI)