m-PEG6-NHS ester, 97.0%
cas: 1449390-12-8 — see every product listed under this CAS number, including other names
m-PEG6-NHS ester, 97.0% (CAS 1449390-12-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 250 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-133066-5 g |
| cas | 1449390-12-8 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 5228.40 Pln | |
| MedChemExpress | 1 g | 1847.57 Pln | |
| MedChemExpress | 250 mg | 672.64 Pln | |
| MedChemExpress | 100 mg | 440.44 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1449390-12-8) is a chemical compound with the molecular formula C18H31NO10 and a molecular weight of 421.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: KIIPLYSZOISNAS-UHFFFAOYSA-N.
| Molecular formula | C18H31NO10 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | KIIPLYSZOISNAS-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)