cas: 1449390-12-8 — see every product listed under this CAS number, including other names
4,7,10,13,16,19-Hexaoxaeicosanoic acid, 2,5-dioxo-1-pyrrolidinyl ester, 95% (CAS 1449390-12-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F861908-100MG |
| cas | 1449390-12-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 409.25 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 1g | 1528.65 Pln | |
| Fluorochem | 5g | 4730.64 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1449390-12-8) is a chemical compound with the molecular formula C18H31NO10 and a molecular weight of 421.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: KIIPLYSZOISNAS-UHFFFAOYSA-N.
| Molecular formula | C18H31NO10 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | KIIPLYSZOISNAS-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)