CAS 1449390-12-8 appears in our catalog under these names: m-PEG6 NHS ester, 98%, m–PEG6–NHS ester, mPEG5-NHS, m-PEG6-NHS ester 97%, m-PEG6-NHS ester, 97.0%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg, 1000mg, 2000mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1449390-12-8) is a chemical compound with the molecular formula C18H31NO10 and a molecular weight of 421.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: KIIPLYSZOISNAS-UHFFFAOYSA-N.
| Molecular formula | C18H31NO10 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | KIIPLYSZOISNAS-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)