cas: 2657-67-2 — see every product listed under this CAS number, including other names
meso-1,2,3,4-Tetrabromobutane (CAS 2657-67-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113TQL-5g |
| cas | 2657-67-2 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 500g | 1574.40 Pln |
| delivery time | 3 weeks |
|---|
(2S,3R)-1,2,3,4-tetrabromobutane (CAS 2657-67-2) is a chemical compound with the molecular formula C4H6Br4 and a molecular weight of 373.71 g/mol. IUPAC name: (2S,3R)-1,2,3,4-tetrabromobutane. InChIKey: HGRZLIGHKHRTRE-ZXZARUISSA-N.
| Molecular formula | C4H6Br4 |
|---|---|
| Molecular weight | 373.71 g/mol |
| IUPAC name | (2S,3R)-1,2,3,4-tetrabromobutane |
| InChIKey | HGRZLIGHKHRTRE-ZXZARUISSA-N |
| SMILES | C([C@H]([C@H](CBr)Br)Br)Br |
Computed by PubChem (NCBI)