cas: 1236862-40-0 — see every product listed under this CAS number, including other names
methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylate hydrochloride, 98% (CAS 1236862-40-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F862544-100MG |
| cas | 1236862-40-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 1565.09 Pln | |
| Fluorochem | 5g | 5324.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 1236862-40-0) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: NZPNZFQTGORIKF-DHXVBOOMSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | NZPNZFQTGORIKF-DHXVBOOMSA-N |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)