CAS 1373512-33-4 appears in our catalog under these names: (R)-γ-(3-Fluoro-benzyl)-L-proline hydroc, hloride, 250 mg, (2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, (2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95+%, (R)-γ-(3-Fluoro-benzyl)-L-proline hydrochloride, (R)-γ-(3-Fluoro-benzyl)-L-proline hydroc, hloride, 100 mg. Offered by: Roth, Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg.
(2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1373512-33-4) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: (2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UEJCKIYKRFAMOV-XQKZEKTMSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | (2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | UEJCKIYKRFAMOV-XQKZEKTMSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)