Products 1881290-82-9
CAS 1881290-82-9 is the registry number for tert-butyl N-(4-chloro-3-fluorophenyl)-N-methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-(4-chloro-3-fluorophenyl)-N-methylcarbamate (CAS 1881290-82-9) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: tert-butyl N-(4-chloro-3-fluorophenyl)-N-methylcarbamate. InChIKey: MBLAHLHXXXPONL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | tert-butyl N-(4-chloro-3-fluorophenyl)-N-methylcarbamate |
| InChIKey | MBLAHLHXXXPONL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=C(C=C1)Cl)F |
Computed by PubChem (NCBI)