methyl 1-benzyl-3-fluoropyrrolidine-3-carboxylate, 98%, 98%
cas: 1279669-60-1 — see every product listed under this CAS number, including other names
methyl 1-benzyl-3-fluoropyrrolidine-3-carboxylate, 98%, 98% (CAS 1279669-60-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12LS6X-100mg |
| cas | 1279669-60-1 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2613.20 Pln | |
| Chemat | 25g | 4682.00 Pln | |
| Chemat | 50g | 6611.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 1-benzyl-3-fluoropyrrolidine-3-carboxylate (CAS 1279669-60-1) is a chemical compound with the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. IUPAC name: methyl 1-benzyl-3-fluoropyrrolidine-3-carboxylate. InChIKey: UQMVXIDFYRQQIS-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO2 |
|---|---|
| Molecular weight | 237.27 g/mol |
| IUPAC name | methyl 1-benzyl-3-fluoropyrrolidine-3-carboxylate |
| InChIKey | UQMVXIDFYRQQIS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(C1)CC2=CC=CC=C2)F |
Computed by PubChem (NCBI)