CAS 1637781-37-3 is the registry number for Cis-tert-butyl 3-(3-fluorophenyl)-aziridine-2-carboxylate, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, 5g, on request.
Tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate (CAS 1637781-37-3) is a chemical compound with the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. IUPAC name: tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate. InChIKey: FOATVYJZLYYGOO-GHMZBOCLSA-N.
| Molecular formula | C13H16FNO2 |
|---|---|
| Molecular weight | 237.27 g/mol |
| IUPAC name | tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate |
| InChIKey | FOATVYJZLYYGOO-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H](N1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)