Products 901313-43-7

CAS 901313-43-7 is the registry number for 1-(2-Fluorobenzyl)piperidine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-[(2-fluorophenyl)methyl]piperidine-4-carboxylic acid (CAS 901313-43-7) is a chemical compound with the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]piperidine-4-carboxylic acid. InChIKey: AXIKZGILESDOKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16FNO2
Molecular weight237.27 g/mol
IUPAC name1-[(2-fluorophenyl)methyl]piperidine-4-carboxylic acid
InChIKeyAXIKZGILESDOKQ-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)CC2=CC=CC=C2F

Computed by PubChem (NCBI)