cas: 59115-08-1 — see every product listed under this CAS number, including other names
methyl 2-methyl-2-(4-nitrophenyl)propanoate, 98%, 98% (CAS 59115-08-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAII-100mg |
| cas | 59115-08-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1802.00 Pln | |
| Chemat | 10g | 3371.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-methyl-2-(4-nitrophenyl)propanoate (CAS 59115-08-1) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 2-methyl-2-(4-nitrophenyl)propanoate. InChIKey: HSQIFLIPJUZWEO-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | methyl 2-methyl-2-(4-nitrophenyl)propanoate |
| InChIKey | HSQIFLIPJUZWEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)