cas: 35212-87-4 — see every product listed under this CAS number, including other names
methyl 3-amino-6-chloro-1-benzothiophene-2-carboxylate, 98% (CAS 35212-87-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F550730-100MG |
| cas | 35212-87-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 1112.13 Pln | |
| Fluorochem | 1g | 2871.92 Pln | |
| Fluorochem | 5g | 6433.17 Pln | |
| Fluorochem | 10g | 10067.31 Pln | |
| Fluorochem | 25g | 15258.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-6-chloro-1-benzothiophene-2-carboxylate (CAS 35212-87-4) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: methyl 3-amino-6-chloro-1-benzothiophene-2-carboxylate. InChIKey: QWXWNCOUMITXRA-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | methyl 3-amino-6-chloro-1-benzothiophene-2-carboxylate |
| InChIKey | QWXWNCOUMITXRA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)