CAS 68321-41-5 is the registry number for 4-(2-Chloroacetyl)-2h-1,4-benzothiazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(2-chloroacetyl)-1,4-benzothiazin-3-one (CAS 68321-41-5) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 4-(2-chloroacetyl)-1,4-benzothiazin-3-one. InChIKey: CYIZUSMRAHFMOI-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 4-(2-chloroacetyl)-1,4-benzothiazin-3-one |
| InChIKey | CYIZUSMRAHFMOI-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=CC=CC=C2S1)C(=O)CCl |
Computed by PubChem (NCBI)