Products 1421602-69-8
CAS 1421602-69-8 is the registry number for 5-(Pyridin-3-yl)thiophene-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 100mg, 1g.
5-pyridin-3-ylthiophene-2-carboxylic acid;hydrochloride (CAS 1421602-69-8) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 5-pyridin-3-ylthiophene-2-carboxylic acid;hydrochloride. InChIKey: LOYYXDUQASQOOD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 5-pyridin-3-ylthiophene-2-carboxylic acid;hydrochloride |
| InChIKey | LOYYXDUQASQOOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(S2)C(=O)O.Cl |
Computed by PubChem (NCBI)