CAS 225928-10-9 appears in our catalog under these names: Methyl 4-(bromoethynyl)benzoate, 95%, Methyl 4-(bromoethynyl)benzoate, 97%, Methyl 4–(Bromoethynyl)Benzoate, methyl 4-(bromoethynyl)benzoate, Methyl 4-(Bromoethynyl)Benzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
Methyl 4-(2-bromoethynyl)benzoate (CAS 225928-10-9) is a chemical compound with the molecular formula C10H7BrO2 and a molecular weight of 239.06 g/mol. IUPAC name: methyl 4-(2-bromoethynyl)benzoate. InChIKey: LVAXOQWVIMIKSJ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2 |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | methyl 4-(2-bromoethynyl)benzoate |
| InChIKey | LVAXOQWVIMIKSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C#CBr |
Computed by PubChem (NCBI)