CAS 102653-68-9 appears in our catalog under these names: 3-Bromo-6-methylchromone, 95%, 3-Bromo-6-methylchromone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
3-bromo-6-methylchromen-4-one (CAS 102653-68-9) is a chemical compound with the molecular formula C10H7BrO2 and a molecular weight of 239.06 g/mol. IUPAC name: 3-bromo-6-methylchromen-4-one. InChIKey: MSGSIDWZOPALIZ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2 |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | 3-bromo-6-methylchromen-4-one |
| InChIKey | MSGSIDWZOPALIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC=C(C2=O)Br |
Computed by PubChem (NCBI)