CAS 102653-36-1 appears in our catalog under these names: 3-Bromonaphthalene-2,7-diol, 95%, 3–Bromonaphthalene–2,7–diol, 3-Bromonaphthalene-2,7-diol 95%, 3-Bromonaphthalene-2,7-diol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
3-bromonaphthalene-2,7-diol (CAS 102653-36-1) is a chemical compound with the molecular formula C10H7BrO2 and a molecular weight of 239.06 g/mol. IUPAC name: 3-bromonaphthalene-2,7-diol. InChIKey: NCGIPELWHJKROR-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2 |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | 3-bromonaphthalene-2,7-diol |
| InChIKey | NCGIPELWHJKROR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)Br)O)O |
Computed by PubChem (NCBI)