cas: 1353101-38-8 — see every product listed under this CAS number, including other names
methyl 6-(trifluoromethyl)pyrimidine-4-carboxylate, 97%, 97% (CAS 1353101-38-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU29-100mg |
| cas | 1353101-38-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1134.80 Pln | |
| Chemat | 500mg | 1845.20 Pln | |
| Chemat | 1g | 2733.20 Pln | |
| Chemat | 5g | 8085.20 Pln | |
| Chemat | 10g | 13014.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-(trifluoromethyl)pyrimidine-4-carboxylate (CAS 1353101-38-8) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: methyl 6-(trifluoromethyl)pyrimidine-4-carboxylate. InChIKey: CACYLJKHDMPBPG-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | methyl 6-(trifluoromethyl)pyrimidine-4-carboxylate |
| InChIKey | CACYLJKHDMPBPG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=N1)C(F)(F)F |
Computed by PubChem (NCBI)