cas: 1355170-70-5 — see every product listed under this CAS number, including other names
methyl 8-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate, 97% (CAS 1355170-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch138OI3-100mg |
| cas | 1355170-70-5 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 500mg | 674.00 Pln | |
| Chemat | 1g | 981.20 Pln | |
| Chemat | 5g | 2814.80 Pln | |
| Chemat | 10g | 4658.00 Pln | |
| Chemat | 25g | 9266.00 Pln | |
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 898.66 Pln | |
| Fluorochem | 500mg | 1242.29 Pln | |
| Fluorochem | 1g | 1809.80 Pln | |
| Fluorochem | 5g | 5214.85 Pln | |
| Fluorochem | 10g | 8484.53 Pln | |
| Fluorochem | 25g | 16919.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 8-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate (CAS 1355170-70-5) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: methyl 8-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate. InChIKey: RJMHIBOUKAMBIK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | methyl 8-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate |
| InChIKey | RJMHIBOUKAMBIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=NC=N2)C(=C1)Br |
Computed by PubChem (NCBI)