cas: 1459-55-8 — see every product listed under this CAS number, including other names
p-(1-Adamantyl)toluene, >95.0%(GC) (CAS 1459-55-8) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1393-5G |
| cas | 1459-55-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 526.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
1-(4-methylphenyl)adamantane (CAS 1459-55-8) is a chemical compound with the molecular formula C17H22 and a molecular weight of 226.36 g/mol. IUPAC name: 1-(4-methylphenyl)adamantane. InChIKey: RFQXTZGKFOTWFL-UHFFFAOYSA-N.
| Molecular formula | C17H22 |
|---|---|
| Molecular weight | 226.36 g/mol |
| IUPAC name | 1-(4-methylphenyl)adamantane |
| InChIKey | RFQXTZGKFOTWFL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)