Products 276890-24-5
CAS 276890-24-5 is the registry number for 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-1H-cyclopenta[b]naphthalene, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,5,8,8-tetramethyl-6,7-dihydro-1H-cyclopenta[b]naphthalene (CAS 276890-24-5) is a chemical compound with the molecular formula C17H22 and a molecular weight of 226.36 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydro-1H-cyclopenta[b]naphthalene. InChIKey: HNLISUVQOFXERR-UHFFFAOYSA-N.
| Molecular formula | C17H22 |
|---|---|
| Molecular weight | 226.36 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydro-1H-cyclopenta[b]naphthalene |
| InChIKey | HNLISUVQOFXERR-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C3CC=CC3=C2)(C)C)C |
Computed by PubChem (NCBI)