cas: 10396-10-8 — see every product listed under this CAS number, including other names
p-Toluenesulfonylsemicarbazide, 95%, 95% (CAS 10396-10-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HA90-10g |
| cas | 10396-10-8 |
| size | 10g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 500g | 369.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(4-methylphenyl)sulfonylamino]urea (CAS 10396-10-8) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: [(4-methylphenyl)sulfonylamino]urea. InChIKey: VRFNYSYURHAPFL-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | [(4-methylphenyl)sulfonylamino]urea |
| InChIKey | VRFNYSYURHAPFL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NNC(=O)N |
Computed by PubChem (NCBI)