CAS 100-15-2 appears in our catalog under these names: N-Methyl-4-nitroaniline, 97%, N-Methyl-4-nitroaniline, >95% (HPLC), N–Methyl–4–nitroaniline, N-Methyl-4-nitroaniline, 97% , N-Methyl-4-nitroaniline. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 500g, 25g, 5g, 250g, 50g.
N-methyl-4-nitroaniline (CAS 100-15-2) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: N-methyl-4-nitroaniline. InChIKey: XIFJZJPMHNUGRA-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | N-methyl-4-nitroaniline |
| InChIKey | XIFJZJPMHNUGRA-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)