CAS 1000-00-6 appears in our catalog under these names: DL-tryptophan ethyl ester hydrochloride, 98%, 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 100g, 1g, 50g.
[diethyl(methyl)silyl]oxy-diethyl-methylsilane (CAS 1000-00-6) is a chemical compound with the molecular formula C10H26OSi2 and a molecular weight of 218.48 g/mol. IUPAC name: [diethyl(methyl)silyl]oxy-diethyl-methylsilane. InChIKey: ILYAQWBKAVFRGF-UHFFFAOYSA-N.
| Molecular formula | C10H26OSi2 |
|---|---|
| Molecular weight | 218.48 g/mol |
| IUPAC name | [diethyl(methyl)silyl]oxy-diethyl-methylsilane |
| InChIKey | ILYAQWBKAVFRGF-UHFFFAOYSA-N |
| SMILES | CC[Si](C)(CC)O[Si](C)(CC)CC |
Computed by PubChem (NCBI)