CAS 36957-90-1 is the registry number for 1,3-Diisopropyl-1,1,3,3-Tetramethyldisiloxane. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
[dimethyl(propan-2-yl)silyl]oxy-dimethyl-propan-2-ylsilane (CAS 36957-90-1) is a chemical compound with the molecular formula C10H26OSi2 and a molecular weight of 218.48 g/mol. IUPAC name: [dimethyl(propan-2-yl)silyl]oxy-dimethyl-propan-2-ylsilane. InChIKey: DSLOWNUUMZVCAC-UHFFFAOYSA-N.
| Molecular formula | C10H26OSi2 |
|---|---|
| Molecular weight | 218.48 g/mol |
| IUPAC name | [dimethyl(propan-2-yl)silyl]oxy-dimethyl-propan-2-ylsilane |
| InChIKey | DSLOWNUUMZVCAC-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C)(C)O[Si](C)(C)C(C)C |
Computed by PubChem (NCBI)