CAS 1000015-88-2 is the registry number for Bis(2,5-dimethylphenyl)iodonium triflate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
Bis(2,5-dimethylphenyl)iodanium;trifluoromethanesulfonate (CAS 1000015-88-2) is a chemical compound with the molecular formula C17H18F3IO3S and a molecular weight of 486.3 g/mol. IUPAC name: bis(2,5-dimethylphenyl)iodanium;trifluoromethanesulfonate. InChIKey: NOYGJUFDVACLMX-UHFFFAOYSA-M.
| Molecular formula | C17H18F3IO3S |
|---|---|
| Molecular weight | 486.3 g/mol |
| IUPAC name | bis(2,5-dimethylphenyl)iodanium;trifluoromethanesulfonate |
| InChIKey | NOYGJUFDVACLMX-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1)C)[I+]C2=C(C=CC(=C2)C)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)