CAS 154557-16-1 is the registry number for (4-(tert-Butyl)phenyl)(phenyl)iodonium trifluoromethanesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
(4-tert-butylphenyl)-phenyliodanium;trifluoromethanesulfonate (CAS 154557-16-1) is a chemical compound with the molecular formula C17H18F3IO3S and a molecular weight of 486.3 g/mol. IUPAC name: (4-tert-butylphenyl)-phenyliodanium;trifluoromethanesulfonate. InChIKey: JWZCSQKZVNXGMT-UHFFFAOYSA-M.
| Molecular formula | C17H18F3IO3S |
|---|---|
| Molecular weight | 486.3 g/mol |
| IUPAC name | (4-tert-butylphenyl)-phenyliodanium;trifluoromethanesulfonate |
| InChIKey | JWZCSQKZVNXGMT-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=CC=C2.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)