CAS 1000304-34-6 appears in our catalog under these names: (1R,2R,5S,6R,7R)-6,8,8-Trimethyl-3-azatricyclo[5.1.1.0(2,5)]nonan-4-one, 95%, (1R,2R,5S,6R,7R)-6,8,8-Trimethyl-3-azatricyclo(5.1.1.02,5)nonan-4-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(1R,2R,5S,6R,7R)-6,8,8-trimethyl-3-azatricyclo[5.1.1.02,5]nonan-4-one (CAS 1000304-34-6) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (1R,2R,5S,6R,7R)-6,8,8-trimethyl-3-azatricyclo[5.1.1.02,5]nonan-4-one. InChIKey: DYJCUNKVHDGMKK-XGQMLPDNSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (1R,2R,5S,6R,7R)-6,8,8-trimethyl-3-azatricyclo[5.1.1.02,5]nonan-4-one |
| InChIKey | DYJCUNKVHDGMKK-XGQMLPDNSA-N |
| SMILES | C[C@@H]1[C@H]2C[C@H](C2(C)C)[C@@H]3[C@H]1C(=O)N3 |
Computed by PubChem (NCBI)