CAS 1000339-34-3 appears in our catalog under these names: 2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol, 98%, 2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 100mg.
2-[1-(4-bromophenyl)triazol-4-yl]propan-2-ol (CAS 1000339-34-3) is a chemical compound with the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. IUPAC name: 2-[1-(4-bromophenyl)triazol-4-yl]propan-2-ol. InChIKey: RSIHPLASTHLNBG-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O |
|---|---|
| Molecular weight | 282.14 g/mol |
| IUPAC name | 2-[1-(4-bromophenyl)triazol-4-yl]propan-2-ol |
| InChIKey | RSIHPLASTHLNBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CN(N=N1)C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)