CAS 2287311-28-6 is the registry number for 6-Bromo-1-(tetrahydro-2H-pyran-3-yl)-1H-benzo[d][1,2,3]triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1-(oxan-3-yl)benzotriazole (CAS 2287311-28-6) is a chemical compound with the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. IUPAC name: 6-bromo-1-(oxan-3-yl)benzotriazole. InChIKey: JVSPDRBZFTYKES-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O |
|---|---|
| Molecular weight | 282.14 g/mol |
| IUPAC name | 6-bromo-1-(oxan-3-yl)benzotriazole |
| InChIKey | JVSPDRBZFTYKES-UHFFFAOYSA-N |
| SMILES | C1CC(COC1)N2C3=C(C=CC(=C3)Br)N=N2 |
Computed by PubChem (NCBI)