CAS 1000341-36-5 appears in our catalog under these names: 3-Bromo-1h-indazole-4-carbonitrile, 95%, 3–Bromo–1H–indazole–4–carbonitrile, 3-Bromo-1H-indazole-4-carbonitrile 95%, 3-Bromo-1H-indazole-4-carbonitrile, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-bromo-2H-indazole-4-carbonitrile (CAS 1000341-36-5) is a chemical compound with the molecular formula C8H4BrN3 and a molecular weight of 222.04 g/mol. IUPAC name: 3-bromo-2H-indazole-4-carbonitrile. InChIKey: FMBYTIGGQXFBKG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrN3 |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 3-bromo-2H-indazole-4-carbonitrile |
| InChIKey | FMBYTIGGQXFBKG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)C#N)Br |
Computed by PubChem (NCBI)