CAS 952206-30-3 is the registry number for 6-Bromoimidazo[1,2-a]pyridine-7-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromoimidazo[1,2-a]pyridine-7-carbonitrile (CAS 952206-30-3) is a chemical compound with the molecular formula C8H4BrN3 and a molecular weight of 222.04 g/mol. IUPAC name: 6-bromoimidazo[1,2-a]pyridine-7-carbonitrile. InChIKey: WPHYPLYNIJVNDH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrN3 |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 6-bromoimidazo[1,2-a]pyridine-7-carbonitrile |
| InChIKey | WPHYPLYNIJVNDH-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C(=CC2=N1)C#N)Br |
Computed by PubChem (NCBI)