CAS 1000370-31-9 is the registry number for (S)-2-((4-((3-fluorobenzyl)oxy)benzylidene)amino)propanamide. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]propanamide (CAS 1000370-31-9) is a chemical compound with the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. IUPAC name: (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]propanamide. InChIKey: RJJDIVMWGWHPFE-LBPRGKRZSA-N.
| Molecular formula | C17H17FN2O2 |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]propanamide |
| InChIKey | RJJDIVMWGWHPFE-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)N)N=CC1=CC=C(C=C1)OCC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)