CAS 1909293-67-9 is the registry number for rac-(3R,4S)-1-Benzyl-3-(2-fluorophenyl)-4-nitropyrrolidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R,4S)-1-benzyl-3-(2-fluorophenyl)-4-nitropyrrolidine (CAS 1909293-67-9) is a chemical compound with the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. IUPAC name: (3R,4S)-1-benzyl-3-(2-fluorophenyl)-4-nitropyrrolidine. InChIKey: JGEJNSUYFKBRNM-DOTOQJQBSA-N.
| Molecular formula | C17H17FN2O2 |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-3-(2-fluorophenyl)-4-nitropyrrolidine |
| InChIKey | JGEJNSUYFKBRNM-DOTOQJQBSA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)[N+](=O)[O-])C3=CC=CC=C3F |
Computed by PubChem (NCBI)