Products 1000544-58-0

CAS 1000544-58-0 is the registry number for 4-Fluoro-3,5-dimethylphenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(4-fluoro-3,5-dimethylphenyl)acetic acid (CAS 1000544-58-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 2-(4-fluoro-3,5-dimethylphenyl)acetic acid. InChIKey: KVZWAVFWDGHWDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO2
Molecular weight182.19 g/mol
IUPAC name2-(4-fluoro-3,5-dimethylphenyl)acetic acid
InChIKeyKVZWAVFWDGHWDQ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)C)CC(=O)O

Computed by PubChem (NCBI)