CAS 1000544-58-0 is the registry number for 4-Fluoro-3,5-dimethylphenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-fluoro-3,5-dimethylphenyl)acetic acid (CAS 1000544-58-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 2-(4-fluoro-3,5-dimethylphenyl)acetic acid. InChIKey: KVZWAVFWDGHWDQ-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-(4-fluoro-3,5-dimethylphenyl)acetic acid |
| InChIKey | KVZWAVFWDGHWDQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C)CC(=O)O |
Computed by PubChem (NCBI)