Products 1000574-42-4
CAS 1000574-42-4 is the registry number for 5-Benzoyl-2-(4-bromophenyl)-1,2-dihydro-3H-1,2,4-triazol-3-one. Offered by: Fluorochem. Available pack sizes: 1g.
5-benzoyl-2-(4-bromophenyl)-4H-1,2,4-triazol-3-one (CAS 1000574-42-4) is a chemical compound with the molecular formula C15H10BrN3O2 and a molecular weight of 344.16 g/mol. IUPAC name: 5-benzoyl-2-(4-bromophenyl)-4H-1,2,4-triazol-3-one. InChIKey: FJZCNJFGOARBRE-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3O2 |
|---|---|
| Molecular weight | 344.16 g/mol |
| IUPAC name | 5-benzoyl-2-(4-bromophenyl)-4H-1,2,4-triazol-3-one |
| InChIKey | FJZCNJFGOARBRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NN(C(=O)N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)