CAS 1417567-95-3 is the registry number for 1,3-Dibromo-4-(difluoromethoxy)benzene, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dibromo-1-(difluoromethoxy)benzene (CAS 1417567-95-3) is a chemical compound with the molecular formula C7H4Br2F2O and a molecular weight of 301.91 g/mol. IUPAC name: 2,4-dibromo-1-(difluoromethoxy)benzene. InChIKey: BGYPGHZJFUWWGQ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F2O |
|---|---|
| Molecular weight | 301.91 g/mol |
| IUPAC name | 2,4-dibromo-1-(difluoromethoxy)benzene |
| InChIKey | BGYPGHZJFUWWGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)OC(F)F |
Computed by PubChem (NCBI)